For research use only. Not for therapeutic Use.
RNase A (Cat No.:I042665) from bovine pancreas is a well-characterized enzyme that catalyzes the degradation of RNA by cleaving the phosphodiester bonds between nucleotides. This enzyme is widely used in molecular biology and biochemistry for applications such as RNA purification, nucleic acid degradation, and studies involving RNA structure and function. RNase A specifically targets single-stranded RNA, making it a valuable tool for removing RNA from DNA preparations. It has also been studied for its potential therapeutic applications, including antimicrobial and anticancer properties, due to its ability to degrade RNA in pathogenic cells.
| CAS Number | 9001-99-4 |
| Purity | ≥95% |
| IUPAC Name | 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | CQOVPNPJLQNMDC-UHFFFAOYSA-N |
| SMILES | C1=C(NC=N1)CC(C(=O)O)NC(=O)CCN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
