For research use only. Not for therapeutic Use.
RNPA1000（Cat No.:I003316）is a high-purity RNA polymerase inhibitor with potent activity against Gram-positive bacterial pathogens. It specifically targets bacterial RNA polymerase (RNAP), disrupting transcription and halting bacterial growth. RNPA1000 is widely studied for its potential to combat antibiotic-resistant infections, offering a novel mechanism of action distinct from traditional antibiotics. Its efficacy against clinically relevant pathogens makes it a valuable tool in antimicrobial research and drug development. This compound is instrumental in exploring transcriptional regulation, bacterial physiology, and innovative strategies for addressing the global challenge of antibiotic resistance.
| Catalog Number | I003316 |
| CAS Number | 359600-10-5 |
| Molecular Formula | C23H18BrN3O3 |
| Purity | ≥95% |
| Target | Antibiotic |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-[3-[(E)-3-(3-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
| InChI | InChI=1S/C23H18BrN3O3/c1-14-10-17(15(2)27(14)21-8-6-16(7-9-21)23(29)30)11-18(13-25)22(28)26-20-5-3-4-19(24)12-20/h3-12H,1-2H3,(H,26,28)(H,29,30)/b18-11+ |
| InChIKey | WQCMDUBFZYCGMI-WOJGMQOQSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)C(=O)O)C)/C=C(\C#N)/C(=O)NC3=CC(=CC=C3)Br |
| Reference | <p style=/line-height:25px/> |
