For research use only. Not for therapeutic Use.
Ro 41-5253（Cat No.:I009148）is a selective small molecule inhibitor that targets the enzyme phosphodiesterase 4 (PDE4), which is involved in regulating cyclic AMP (cAMP) levels within cells. PDE4 plays a key role in modulating inflammatory responses and immune cell function. By inhibiting PDE4, Ro 41-5253 helps to increase cAMP levels, thereby reducing inflammation and modulating immune system activity. This compound has potential therapeutic applications in treating inflammatory diseases, such as asthma, chronic obstructive pulmonary disease (COPD), and other conditions associated with excessive inflammation. It is being studied for its anti-inflammatory effects and clinical benefits.
| CAS Number | 144092-31-9 |
| Synonyms | 4-[(E)-2-(7-heptoxy-4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)prop-1-enyl]benzoic acid |
| Molecular Formula | C28H36O5S |
| Purity | ≥95% |
| IUPAC Name | 4-[(E)-2-(7-heptoxy-4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)prop-1-enyl]benzoic acid |
| InChI | InChI=1S/C28H36O5S/c1-5-6-7-8-9-15-33-25-19-26-24(28(3,4)14-16-34(26,31)32)18-23(25)20(2)17-21-10-12-22(13-11-21)27(29)30/h10-13,17-19H,5-9,14-16H2,1-4H3,(H,29,30)/b20-17+ |
| InChIKey | JEIWQRITHXYGIF-LVZFUZTISA-N |
| SMILES | CCCCCCCOC1=CC2=C(C=C1/C(=C/C3=CC=C(C=C3)C(=O)O)/C)C(CCS2(=O)=O)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
