For research use only. Not for therapeutic Use.
RO8191 (CAT: I011640) is a small molecule inhibitor that targets the enzyme lactate dehydrogenase A (LDHA), which is involved in the conversion of pyruvate to lactate in cells. LDHA is often overexpressed in various types of cancer and plays a key role in promoting tumor growth and survival. By inhibiting LDHA, RO8191 can disrupt the metabolism of cancer cells, leading to reduced proliferation and increased cell death. RO8191 has been studied for its potential therapeutic applications in various types of cancer, including breast cancer, pancreatic cancer, and leukemia. In addition, it has also been investigated for its potential to enhance the effectiveness of other anticancer therapies, such as chemotherapy and radiation therapy.
CAS Number | 691868-88-9 |
Synonyms | 8-(1,3,4-oxadiazol-2-yl)-2,4-<em>bis</em>(trifluoromethyl)-imidazo[1,2-a][1,8]naphthyridine |
Molecular Formula | C14H5F6N5O |
Purity | ≥95% |
Target | Protein Tyrosine Kinase/RTK |
Solubility | Soluble in DMSO |
Storage | Store at 2°C to 8°C |
IUPAC Name | 2-[2,4-bis(trifluoromethyl)imidazo[1,2-a][1,8]naphthyridin-8-yl]-1,3,4-oxadiazole |
InChI | InChI=1S/C14H5F6N5O/c15-13(16,17)7-3-9(14(18,19)20)23-11-6(7)1-2-10-22-8(4-25(10)11)12-24-21-5-26-12/h1-5H |
InChIKey | GRHYZVJEXKTJOS-UHFFFAOYSA-N |
SMILES | C1=CC2=NC(=CN2C3=C1C(=CC(=N3)C(F)(F)F)C(F)(F)F)C4=NN=CO4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |