For research use only. Not for therapeutic Use.
Robinetin(Cat No.:R047331) is a natural flavonol found in various plant sources. Its mode of action involves serving as an antioxidant, scavenging free radicals and reducing oxidative stress. Robinetin exhibits potential pharmacological properties with a focus on cardiovascular health, immune function support, and anti-inflammatory effects. As a flavonoid, it contributes to the color and taste of plant-based foods and beverages. Due to its antioxidant activity, Robinetin has attracted attention in research for potential applications in nutraceuticals and functional foods aimed at promoting overall well-being and reducing the risk of chronic diseases.
CAS Number | 490-31-3 |
Molecular Formula | C15H10O7 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | 3 years -20C powder |
IUPAC Name | 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
InChI | InChI=1S/C15H10O7/c16-7-1-2-8-11(5-7)22-15(14(21)12(8)19)6-3-9(17)13(20)10(18)4-6/h1-5,16-18,20-21H |
InChIKey | SOEDEYVDCDYMMH-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1O)OC(=C(C2=O)O)C3=CC(=C(C(=C3)O)O)O |