For research use only. Not for therapeutic Use.
ROCK2-IN-6 hydrochloride (Comp A) is a selective ROCK2 inhibitor, can be used for ROCK mediated diseases, autoimmune diseases and inflammation research[1].
| Catalog Number | I040777 |
| CAS Number | 2762238-94-6 |
| Synonyms | (3,3-difluoroazetidin-1-yl)-[1-methyl-6-[4-[4-(1H-pyrazol-4-yl)anilino]pyrimidin-2-yl]indol-2-yl]methanone;hydrochloride |
| Molecular Formula | C26H22ClF2N7O |
| Purity | ≥95% |
| InChI | InChI=1S/C26H21F2N7O.ClH/c1-34-21-11-18(3-2-17(21)10-22(34)25(36)35-14-26(27,28)15-35)24-29-9-8-23(33-24)32-20-6-4-16(5-7-20)19-12-30-31-13-19;/h2-13H,14-15H2,1H3,(H,30,31)(H,29,32,33);1H |
| InChIKey | JUYJQRIBIRQCLR-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=C1C=C(C=C2)C3=NC=CC(=N3)NC4=CC=C(C=C4)C5=CNN=C5)C(=O)N6CC(C6)(F)F.Cl |
| Reference | [1]. Wang HJ, et.al Solid form of rho-associated protein kinase inhibitor or solvate thereof, preparation method and use thereof |
