For research use only. Not for therapeutic Use.
Roflupram（Cat No.:I027448）is a selective inhibitor of phosphodiesterase 4 (PDE4), an enzyme responsible for breaking down cyclic AMP (cAMP) in cells. By inhibiting PDE4, Roflupram increases cAMP levels, leading to reduced inflammation and modulated immune responses. This makes it a potential therapeutic candidate for treating inflammatory diseases such as chronic obstructive pulmonary disease (COPD), asthma, and psoriasis, where excessive inflammation is a key factor. Roflupram is being studied for its ability to provide anti-inflammatory effects and improve symptoms associated with these chronic conditions, offering a targeted approach to inflammation management.
| CAS Number | 1093412-18-0 |
| Synonyms | 1-[4-(difluoromethoxy)-3-(oxolan-3-yloxy)phenyl]-3-methylbutan-1-one |
| Molecular Formula | C16H20F2O4 |
| Purity | ≥95% |
| IUPAC Name | 1-[4-(difluoromethoxy)-3-(oxolan-3-yloxy)phenyl]-3-methylbutan-1-one |
| InChI | InChI=1S/C16H20F2O4/c1-10(2)7-13(19)11-3-4-14(22-16(17)18)15(8-11)21-12-5-6-20-9-12/h3-4,8,10,12,16H,5-7,9H2,1-2H3 |
| InChIKey | IXURVUHDDXFYDR-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=CC(=C(C=C1)OC(F)F)OC2CCOC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
