For research use only. Not for therapeutic Use.
Rogaratinib (Cat No.:I009176) is a potent and selective tyrosine kinase inhibitor with potential antineoplastic activity. It primarily targets the fibroblast growth factor receptor (FGFR) family, inhibiting their activation and downstream signaling pathways involved in cell proliferation, angiogenesis, and tumor growth. Rogaratinib’s unique binding mode allows it to overcome certain resistance mutations commonly associated with FGFR inhibitors. This chemical has shown promise in preclinical and clinical studies for the treatment of advanced solid tumors, including FGFR-altered cancers, making it a potential candidate for targeted therapy in oncology.
CAS Number | 1443530-05-9 |
Synonyms | Rogaratinib; BAY-1163877: BAY1163877: BAY 1163877;4-((4-amino-5-(7-methoxy-5-methylbenzo[b]thiophen-2-yl)-6-(methoxymethyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl)methyl)piperazin-2-one |
Molecular Formula | C23H26N6O3S |
Purity | ≥95% |
Target | FGFR |
Solubility | Soluble in DMSO |
Storage | Desiccate at RT |
IUPAC Name | 4-[[4-amino-6-(methoxymethyl)-5-(7-methoxy-5-methyl-1-benzothiophen-2-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]methyl]piperazin-2-one |
InChI | InChI=1S/C23H26N6O3S/c1-13-6-14-8-18(33-22(14)17(7-13)32-3)20-15(11-31-2)16(9-28-5-4-25-19(30)10-28)29-21(20)23(24)26-12-27-29/h6-8,12H,4-5,9-11H2,1-3H3,(H,25,30)(H2,24,26,27) |
InChIKey | HNLRRJSKGXOYNO-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C(=C1)OC)SC(=C2)C3=C4C(=NC=NN4C(=C3COC)CN5CCNC(=O)C5)N |
Reference | 1. Oncogenesis. 2016 Jul 18;5(7):e241. doi: 10.1038/oncsis.2016.48. <br /> |