For research use only. Not for therapeutic Use.
Romifidine(CAT: I013991) is a synthetic alpha-2 adrenergic agonist drug used primarily in veterinary medicine as a sedative, analgesic, and muscle relaxant for horses and other large animals. It works by binding to alpha-2 adrenergic receptors in the central nervous system, resulting in a decrease in sympathetic nervous system activity, and causing sedation and analgesia. Romifidine has a relatively long duration of action, typically lasting several hours, and is administered via intravenous injection or infusion. It is also used in combination with other drugs for anesthesia during surgery or other medical procedures. It has a sedative effect and can cause side effects such as bradycardia (slow heart rate), respiratory depression, and hypotension (low blood pressure).
CAS Number | 65896-16-4 |
Molecular Formula | C9H9BrFN3 |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | N-(2-bromo-6-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine |
InChI | InChI=1S/C9H9BrFN3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14) |
InChIKey | KDPNLRQZHDJRFU-UHFFFAOYSA-N |
SMILES | C1CN=C(N1)NC2=C(C=CC=C2Br)F |