For research use only. Not for therapeutic Use.
Ropivacaine-d7 hydrochloride(Cat No.:S000508) is a deuterated form of ropivacaine hydrochloride, where seven hydrogen atoms are replaced with deuterium. Ropivacaine is a local anesthetic commonly used for surgical anesthesia and for managing acute pain, particularly in postoperative settings. The deuterium substitution in Ropivacaine-d7 enhances its metabolic stability, allowing for more detailed pharmacokinetic studies. These studies provide insights into how ropivacaine is metabolized and cleared from the body, aiding in the optimization of dosing regimens to improve efficacy and minimize potential side effects.
CAS Number | 1217667-10-1 |
Molecular Formula | C17H20D7ClN2O |
Purity | ≥95% |
IUPAC Name | (2S)-N-(2,6-dimethylphenyl)-1-(1,1,2,2,3,3,3-heptadeuteriopropyl)piperidine-2-carboxamide;hydrochloride |
InChI | InChI=1S/C17H26N2O.ClH/c1-4-11-19-12-6-5-10-15(19)17(20)18-16-13(2)8-7-9-14(16)3;/h7-9,15H,4-6,10-12H2,1-3H3,(H,18,20);1H/t15-;/m0./s1/i1D3,4D2,11D2; |
InChIKey | NDNSIBYYUOEUSV-JRDUKJLFSA-N |
SMILES | CCCN1CCCCC1C(=O)NC2=C(C=CC=C2C)C.Cl |