For research use only. Not for therapeutic Use.
ROS-IN-1 is a mitochondrial ROS inhibitor. ROS-IN-1 can reduce oxidative stress or inhibit reactive oxygen species (ROS) production[1].
ROS-IN-1 (Compound 40) can reduce ROS production (25.1%)[1].
Catalog Number | I041144 |
CAS Number | 298193-11-0 |
Synonyms | 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidin-2-one |
Molecular Formula | C13H17NO3S |
Purity | ≥95% |
InChI | InChI=1S/C13H17NO3S/c1-9-7-10(2)13(11(3)8-9)18(16,17)14-6-4-5-12(14)15/h7-8H,4-6H2,1-3H3 |
InChIKey | UVXZHJFRFIKQMT-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N2CCCC2=O)C |
Reference | [1]. Martin D, et al. Compounds and methods for modulating mitochondrial metabolism and reactive oxygen species production. Patent. US20140128352A1. |