For research use only. Not for therapeutic Use.
Rosmarinic acid（Cat No.:I002562） is a naturally-occurring polyphenol known for its antioxidative and anti-inflammatory properties. It exhibits potent antioxidant effects, found in various herbs, such as rosemary and basil, protecting against oxidative stress-induced damage. Additionally, rosmarinic acid demonstrates anti-inflammatory activity by inhibiting inflammatory mediators and enzymes. Its natural origin, along with its antioxidative and anti-inflammatory properties, positions rosmarinic acid as a promising compound for potential therapeutic applications in various diseases and as a dietary supplement for overall health and well-being.
| Catalog Number | I002562 |
| CAS Number | 20283-92-5 |
| Synonyms | (R)-α-[[3-(3,4-dihydroxyphenyl)-1-oxo-2E-propenyl]oxy]-3,4-dihydroxy-benzenepropanoic acid |
| Molecular Formula | C18H16O8 |
| Purity | ≥95% |
| Solubility | DMSO: ≥ 32 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | (2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid |
| InChI | InChI=1S/C18H16O8/c19-12-4-1-10(7-14(12)21)3-6-17(23)26-16(18(24)25)9-11-2-5-13(20)15(22)8-11/h1-8,16,19-22H,9H2,(H,24,25)/b6-3+/t16-/m1/s1 |
| InChIKey | DOUMFZQKYFQNTF-WUTVXBCWSA-N |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O)O |
| Reference | <p style=/line-height:25px/> |
