For research use only. Not for therapeutic Use.
Rostafuroxin (Cat.No:I001990) is a compound known for its antihypertensive properties. It acts as a potent antagonist of the α1-Na⁺/K⁺ ATPase isoform, which regulates sodium and potassium transport in cells. Rostafuroxin has shown potential in preclinical studies for the treatment of hypertension by modulating ion transport and cardiovascular function.
| Catalog Number | I001990 |
| CAS Number | 156722-18-8 |
| Synonyms | (3S,5R,8R,9S,10S,13S,14S,17S)-17-(furan-3-yl)-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
| Molecular Formula | C23H34O4 |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 1.5 nM |
| IUPAC Name | (3S,5R,8R,9S,10S,13S,14S,17S)-17-(furan-3-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,14,17-triol |
| InChI | InChI=1S/C23H34O4/c1-20-8-5-17(24)13-15(20)3-4-19-18(20)6-9-21(2)22(25,10-11-23(19,21)26)16-7-12-27-14-16/h7,12,14-15,17-19,24-26H,3-6,8-11,13H2,1-2H3/t15-,17+,18+,19-,20+,21-,22+,23+/m1/s1 |
| InChIKey | AEAPORIZZWBIEX-DTBDINHYSA-N |
| SMILES | O[C@H]1CC[C@@]2(C)[C@@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@]3(O)CC[C@]4(O)C5=COC=C5)([H])C1 |
