For research use only. Not for therapeutic Use.
Rosuvastatin Calcium(Cat No.:A000888)is a potent HMG-CoA reductase inhibitor, commonly known as a statin, used to lower cholesterol levels and reduce cardiovascular risk. By inhibiting HMG-CoA reductase, it decreases cholesterol biosynthesis in the liver, leading to reduced LDL cholesterol and triglycerides, while slightly raising HDL cholesterol. This effect helps prevent atherosclerosis and related conditions, such as heart attacks and strokes. Rosuvastatin Calcium’s high efficacy and favorable safety profile make it widely prescribed in hyperlipidemia management, while ongoing research explores its potential in anti-inflammatory and anti-atherosclerotic applications.
CAS Number | 147098-20-2 |
Synonyms | ZD4522 |
Molecular Formula | C22H28FN3O6S • 1/2Ca |
Purity | ≥95% |
Target | Autophagy |
Solubility | >28.6mg/mL in DMSO |
Storage | 3 years -20C powder |
IUPAC Name | calcium;(E,3R,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate |
InChI | InChI=1S/2C22H28FN3O6S.Ca/c2*1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32;/h2*5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30);/q;;+2/p-2/b2*10-9+;/t2*16-,17-;/m11./s1 |
InChIKey | LALFOYNTGMUKGG-BGRFNVSISA-L |
SMILES | CC(C1=NC(=NC(=C1/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])C2=CC=C(C=C2)F)N(S(=O)(=O)C)C)C.CC(C1=NC(=NC(=C1/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])C2=CC=C(C=C2)F)N(S(=O)(=O)C)C)C.[Ca+2] |