For research use only. Not for therapeutic Use.
Rotoxamine is an antihistamine.
| Catalog Number | I035701 |
| CAS Number | 5560-77-0 |
| Synonyms | Rotoxamine |
| Molecular Formula | C16H19ClN2O |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (S)-2-((4-chlorophenyl)(pyridin-2-yl)methoxy)-N,N-dimethylethan-1-amine |
| InChI | InChI=1S/C16H19ClN2O/c1-19(2)11-12-20-16(15-5-3-4-10-18-15)13-6-8-14(17)9-7-13/h3-10,16H,11-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | OJFSXZCBGQGRNV-INIZCTEOSA-N |
| SMILES | CN(C)CCO[C@@H](c1ccc(Cl)cc1)c2ccccn2 |
