For research use only. Not for therapeutic Use.
Rotoxamine（Cat No.:I035701）is a synthetic compound studied for its potential as an analgesic and anti-inflammatory agent. It belongs to a class of drugs known to act on the central nervous system, modulating pain pathways to alleviate discomfort. Rotoxamine has been explored for its role in treating conditions like chronic pain, arthritis, and other inflammatory disorders. Its mechanism of action is believed to involve the inhibition of certain neurotransmitter systems that mediate pain and inflammation. However, more clinical research is needed to determine its efficacy, safety, and potential therapeutic uses in various conditions.
| Catalog Number | I035701 |
| CAS Number | 5560-77-0 |
| Synonyms | Rotoxamine |
| Molecular Formula | C16H19ClN2O |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-[(S)-(4-chlorophenyl)-pyridin-2-ylmethoxy]-N,N-dimethylethanamine |
| InChI | InChI=1S/C16H19ClN2O/c1-19(2)11-12-20-16(15-5-3-4-10-18-15)13-6-8-14(17)9-7-13/h3-10,16H,11-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | OJFSXZCBGQGRNV-INIZCTEOSA-N |
| SMILES | CN(C)CCO[C@@H](C1=CC=C(C=C1)Cl)C2=CC=CC=N2 |
