For research use only. Not for therapeutic Use.
RP-54745 exhibits promising antirheumatic potential due to its ability to inhibit the production of two key cytokines, macrophage-stimulating and interleukin-1. By reducing the levels of these cytokines, RP-54745 may help mitigate the inflammation and joint damage associated with rheumatoid arthritis.
| Catalog Number | I013584 |
| CAS Number | 135330-08-4 |
| Molecular Formula | C₁₃H₁₂ClNOS₂ |
| Purity | ≥95% |
| Target | Interleukin Related |
| Solubility | DMSO |
| Storage | 2-8°C |
| IUPAC Name | 4-chloro-5-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)dithiol-3-one |
| InChI | InChI=1S/C13H12ClNOS2/c1-8-10-5-3-2-4-9(10)6-7-15(8)12-11(14)13(16)18-17-12/h2-5,8H,6-7H2,1H3 |
| InChIKey | BEJJGVDFQORITE-UHFFFAOYSA-N |
| SMILES | CC1C2=CC=CC=C2CCN1C3=C(C(=O)SS3)Cl |
| Reference | [1]. Folliard F, et al. RP 54745, a potential antirheumatic compound. I. Inhibitor of macrophage stimulation and interleukin-1 production. Agents Actions. 1992 May;36(1-2):119-26.<br>[2]. Folliard F, et al. RP 54745, a potential antirheumatic compound. II. In vivo properties in different animal models. Agents Actions. 1992 May;36(1-2):127-35. |
