For research use only. Not for therapeutic Use.
RPA 202248 is a selective antagonist used in neuroscience and pharmacological research. It targets specific receptors in the brain, aiding in the study of neurological pathways and disorders. This compound is essential for investigating the mechanisms of action of neurotransmitters and developing new treatments for neurological conditions, ensuring precise and reliable results in advanced research.
| Catalog Number | R016101 |
| CAS Number | 143701-75-1 |
| Synonyms | α-(Cyclopropylcarbonyl)-2-(methylsulfonyl)-β-oxo-4-(trifluoromethyl)benzenepropanenitrile |
| Molecular Formula | C15H12F3NO4S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-(cyclopropanecarbonyl)-3-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]-3-oxopropanenitrile |
| InChI | InChI=1S/C15H12F3NO4S/c1-24(22,23)12-6-9(15(16,17)18)4-5-10(12)14(21)11(7-19)13(20)8-2-3-8/h4-6,8,11H,2-3H2,1H3 |
| InChIKey | ZTTKDUXKVPEXCG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)C(F)(F)F)C(=O)C(C#N)C(=O)C2CC2 |
