For research use only. Not for therapeutic Use.
(R,R)-Hymeglusin（Cat No.:I007557）is a fungal metabolite and potent inhibitor of 3-hydroxy-3-methylglutaryl-CoA (HMG-CoA) synthase, a key enzyme in the mevalonate pathway. By disrupting this pathway, it impacts cholesterol biosynthesis and other isoprenoid-derived processes, making it valuable in metabolic and lipid research. Its stereospecific (R,R) configuration enhances its inhibitory activity, offering insights into enzyme regulation and metabolic disorders. (R,R)-Hymeglusin serves as a critical tool for studying cellular lipid homeostasis, exploring potential therapeutic strategies for hypercholesterolemia, and understanding the biochemical intricacies of isoprenoid synthesis in various biological systems.
| Catalog Number | I007557 |
| CAS Number | 29066-42-0 |
| Synonyms | Hymeglusin; L-659,699; L 659,699; L659,699.;(2E,4E,7R)-11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4-dienoic acid |
| Molecular Formula | C₁₈H₂₈O₅ |
| Purity | ≥95% |
| Target | Dengue virus |
| Solubility | Soluble in DMSO |
| Storage | -20°C |
| IUPAC Name | (2E,4E,7R)-11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4-dienoic acid |
| InChI | InChI=1S/C18H28O5/c1-12(8-13(2)9-14(3)10-17(20)21)6-4-5-7-16-15(11-19)18(22)23-16/h9-10,12,15-16,19H,4-8,11H2,1-3H3,(H,20,21)/b13-9+,14-10+/t12-,15-,16-/m1/s1 |
| InChIKey | ODCZJZWSXPVLAW-KXCGKLMDSA-N |
| SMILES | C[C@H](CCCC[C@@H]1[C@H](C(=O)O1)CO)C/C(=C/C(=C/C(=O)O)/C)/C |
| Reference | 1:The reversal of the inhibition on lipids synthesis by L-659,699 in arterial smooth muscle cells cultures. Carazo A, Alejandre MJ, Louktibi A, Linares A.Mol Cell Biochem. 2001 May;221(1-2):25-31. PMID: 11506182<br /> |
