Home
>
Isotope Labeled Compounds>Isotope Labeled Metabolites>
>
(R,S)-α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic Acid-13C2,15N
(R,S)-α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic Acid-13C2,15N is an isotopically labeled form of (R,S)-α-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid (AMPA), featuring two carbon-13 isotopes and one nitrogen-15 isotope. This compound is used in biochemical and pharmacological research to study the AMPA receptor, which is involved in synaptic transmission and plasticity in the brain. The carbon-13 and nitrogen-15 labeling enhances the precision of analytical techniques such as NMR and mass spectrometry. It allows for detailed investigations into the receptor’s structure, dynamics, and interactions, aiding in drug discovery and understanding the mechanisms underlying neurological functions and disorders.
Catalog Number | R012871 |
CAS Number | 1219376-36-9 |
Synonyms | D,L-α-Amino-3-hydroxy-5-methylisoxazole-4-propionic Acid-13C2,15N; AMPA-13C2,15N ; ?D,L-α-Amino-3-hydroxy-5-methylisoxazole-4-propionic Acid-13C2,15N; γ-Amino-3-hydroxy-5-methylisoxazole-4-propionic Αcid-13C2,15N ; |
Molecular Formula | C7H10N2O4 |
Purity | 95% |
Storage | Desiccate at +4C |
IUPAC Name | 2-azanyl-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)propanoic acid |
InChI | InChI=1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12)/i5+1,7+1,8+1 |
InChIKey | UUDAMDVQRQNNHZ-QIOHBQFSSA-N |
SMILES | CC1=C(C(=O)NO1)CC(C(=O)O)N |