For research use only. Not for therapeutic Use.
(R, S)-1-(3,4-(Methylenedioxy)-6-nitrophenyl)ethyl chloroformate(Cat No.:M099396) is a complex organic compound featuring a chiral center, indicated by the (R, S) designation which represents its racemic form, containing both enantiomers in equal proportions. This compound consists of an ethyl chloroformate group attached to a benzene ring. The benzene ring is modified by a methylenedioxy group linking the 3rd and 4th positions and a nitro group at the 6th position. This structural arrangement is significant in synthetic chemistry, often used in peptide synthesis as a protecting or activating agent due to its ability to interact with various functional groups.
CAS Number | 156876-26-5 |
Molecular Formula | C10H8ClNO6 |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 1-(6-nitro-1,3-benzodioxol-5-yl)ethyl carbonochloridate |
InChI | InChI=1S/C10H8ClNO6/c1-5(18-10(11)13)6-2-8-9(17-4-16-8)3-7(6)12(14)15/h2-3,5H,4H2,1H3 |
InChIKey | LLQGXKKNTCFHEE-UHFFFAOYSA-N |
SMILES | CC(C1=CC2=C(C=C1[N+](=O)[O-])OCO2)OC(=O)Cl |