For research use only. Not for therapeutic Use.
RS-25344 hydrochloride (Cat No.:I009207) is a bioactive compound that acts as a selective antagonist for the dopamine D2 receptor. It exhibits high affinity and specificity for the D2 receptor, which plays a crucial role in neurotransmission and modulation of various physiological processes. By blocking the D2 receptor, RS-25344 HCl interferes with dopamine signaling pathways and can have effects on behavior, mood, and other neurological functions. The hydrochloride form of RS-25344 enhances its stability and solubility, making it suitable for research and experimental purposes in studying dopamine receptor function and related therapeutic interventions.
| Catalog Number | I009207 |
| CAS Number | 152815-28-6(RS-25344 HCl); 152814-89-6 (RS-25344). |
| Synonyms | RS-25344 HCl; RS 25344 HCl; RS25344 HCl.;1-(3-Nitrophenyl)-3-(4-pyridinylmethyl)-pyrido[2,3-d]pyrimidine-2,3-(1H,3H)-dione hydrochloride |
| Molecular Formula | C19H18ClN5O4 |
| Purity | ≥95% |
| Target | Phosphodiesterase (PDE) |
| Solubility | Soluble in DMSO |
| Storage | Desiccate at RT |
| IC50 | 330 nM |
| IUPAC Name | 1-(3-nitrophenyl)-3-(pyridin-4-ylmethyl)pyrido[2,3-d]pyrimidine-2,4-dione;hydrochloride |
| InChI | InChI=1S/C19H13N5O4.ClH/c25-18-16-5-2-8-21-17(16)23(14-3-1-4-15(11-14)24(27)28)19(26)22(18)12-13-6-9-20-10-7-13;/h1-11H,12H2;1H |
| InChIKey | ROSFKXDQMBPYQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])N2C3=C(C=CC=N3)C(=O)N(C2=O)CC4=CC=NC=C4.Cl |
| Reference | </br>1. Bajpai et al (2006) AKAP3 selectively binds PDE4A isoforms in bovine spermatozoa. Biol.Reprod. 74 109. PMID: 16177223.</br>2. Alvarez et al (1995) Activation and selective inhibition of a cyclic AMP-specific phosphodiesterase, PDE-4D3. Mol.Pharmac |
