For research use only. Not for therapeutic Use.
(RS)-3-Hydroxyphenylglycine (Cat.No:I010192) is a chemical compound used in the synthesis of pharmaceuticals and natural products. It is a chiral amino acid derivative with a hydroxyphenyl group attached to a glycine molecule. (RS)-3-Hydroxyphenylglycine is commonly employed as a building block in organic chemistry to create complex molecules with specific pharmacological properties.
CAS Number | 31932-87-3 |
Synonyms | Alternative Name: (RS)-3H-PG |
Molecular Formula | C8H9NO3 |
Purity | ≥95% |
Target | GluR |
Solubility | Soluble to 100 mM in 1eq. NaOH |
Storage | Desiccate at RT |
IUPAC Name | 2-amino-2-(3-hydroxyphenyl)acetic acid |
InChI | InChI=1S/C8H9NO3/c9-7(8(11)12)5-2-1-3-6(10)4-5/h1-4,7,10H,9H2,(H,11,12) |
InChIKey | DQLYTFPAEVJTFM-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)O)C(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |