For research use only. Not for therapeutic Use.
(RS)-3-Hydroxyphenylglycine (Cat.No:I010192) is a chemical compound used in the synthesis of pharmaceuticals and natural products. It is a chiral amino acid derivative with a hydroxyphenyl group attached to a glycine molecule. (RS)-3-Hydroxyphenylglycine is commonly employed as a building block in organic chemistry to create complex molecules with specific pharmacological properties.
| Catalog Number | I010192 |
| CAS Number | 31932-87-3 |
| Synonyms | Alternative Name: (RS)-3H-PG |
| Molecular Formula | C8H9NO3 |
| Purity | ≥95% |
| Target | GluR |
| Solubility | Soluble to 100 mM in 1eq. NaOH |
| Storage | Desiccate at RT |
| IUPAC Name | 2-amino-2-(3-hydroxyphenyl)acetic acid |
| InChI | InChI=1S/C8H9NO3/c9-7(8(11)12)5-2-1-3-6(10)4-5/h1-4,7,10H,9H2,(H,11,12) |
| InChIKey | DQLYTFPAEVJTFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(C(=O)O)N |
