For research use only. Not for therapeutic Use.
AMPA (α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid, CAT: I004812) is the prototypical and defining agonist for the AMPA (α-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid) subgroup of ionotropic glutamate receptors. Glutamate receptors are critical for excitatory neurotransmission in the central nervous system. Activation of AMPA receptors by AMPA leads to the influx of cations, particularly sodium (Na+) and calcium (Ca2+), into the postsynaptic neuron, resulting in neuronal depolarization and the initiation of excitatory synaptic transmission. AMPA receptors play a fundamental role in synaptic plasticity, learning, and memory processes.
| Catalog Number | I004812 |
| CAS Number | 74341-63-2 |
| Synonyms | (RS)-α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid |
| Molecular Formula | C7H10N2O4 |
| Purity | ≥95% |
| Target | AMPAR |
| Solubility | Soluble to 10 mM in water with gentle warming |
| Storage | Store at RT |
| IUPAC Name | 2-amino-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)propanoic acid |
| InChI | InChI=1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | UUDAMDVQRQNNHZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NO1)CC(C(=O)O)N |
| Reference | 1: Rainbow TC, Wieczorek CM, Halpain S. Quantitative autoradiography of binding </br> |
