For research use only. Not for therapeutic Use.
(R,S)-Anatabine-2,4,5,6-d4 is a deuterated form of anatabine, a minor alkaloid found in plants like tobacco. The molecule has deuterium atoms replacing hydrogen at positions 2, 4, 5, and 6, which can be used in metabolic studies and tracing due to the isotope’s heavier mass. The (R,S) notation indicates that the compound is a racemic mixture of two enantiomers, meaning it contains equal parts of both the R and S stereoisomers.
CAS Number | 1020719-11-2 |
Synonyms | (+/-)-1,2,3,6-Tetrahydro-2,3’-bipyridine-d4; (+/-)-Anatabine-d4; |
Molecular Formula | C10H12N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3,4,6-tetradeuterio-5-(1,2,3,6-tetrahydropyridin-2-yl)pyridine |
InChI | InChI=1S/C10H12N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h1-4,6,8,10,12H,5,7H2/i3D,4D,6D,8D |
InChIKey | SOPPBXUYQGUQHE-AJEVBKBKSA-N |
SMILES | C1C=CCNC1C2=CN=CC=C2 |