For research use only. Not for therapeutic Use.
(R,S)-N-Ethyl Nornicotine is a nicotine derivative that features an ethyl group attached to the nitrogen atom of nornicotine, a naturally occurring alkaloid found in tobacco. This compound is of interest in pharmacological research due to its interaction with nicotinic acetylcholine receptors, which play a critical role in neurobiology and addiction. The (R,S) designation indicates a racemic mixture of both enantiomers, each potentially exhibiting distinct biological activities. Investigations into (R,S)-N-Ethyl Nornicotine focus on its effects on neurotransmission, potential therapeutic applications for neurodegenerative diseases, and its role in understanding nicotine addiction and dependence, offering insights into tobacco-related health issues.
CAS Number | 86900-39-2 |
Synonyms | Homonicotine; 3-(1-Ethyl-2-pyrrolidinyl)pyridine; (±)-3-(1-Ethyl-2-pyrrolidinyl)pyridine; |
Molecular Formula | C11H16N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-(1-ethylpyrrolidin-2-yl)pyridine |
InChI | InChI=1S/C11H16N2/c1-2-13-8-4-6-11(13)10-5-3-7-12-9-10/h3,5,7,9,11H,2,4,6,8H2,1H3 |
InChIKey | VXSLBTSUIZUVFX-UHFFFAOYSA-N |
SMILES | CCN1CCCC1C2=CN=CC=C2 |