For research use only. Not for therapeutic Use.
RS100329 hydrochloride(Cat No.:I010391)is a selective inhibitor of the protein kinase enzyme, phosphoinositide 3-kinase (PI3K), which is involved in regulating cellular processes such as growth, survival, and metabolism. Overactive PI3K signaling is often associated with various cancers, autoimmune disorders, and inflammation. By targeting and inhibiting PI3K, RS100329 hydrochloride aims to disrupt cancer cell proliferation and survival, making it a potential therapeutic agent in oncology. Currently undergoing preclinical and clinical trials, RS100329 hydrochloride is being explored for its efficacy and safety in treating cancer and inflammatory diseases.
CAS Number | 1215654-26-4 |
Synonyms | 5-methyl-3-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-1H-pyrimidine-2,4-dione;hydrochloride |
Molecular Formula | C20H26ClF3N4O3 |
Purity | ≥95% |
IUPAC Name | 5-methyl-3-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-1H-pyrimidine-2,4-dione;hydrochloride |
InChI | InChI=1S/C20H25F3N4O3.ClH/c1-15-13-24-19(29)27(18(15)28)8-4-7-25-9-11-26(12-10-25)16-5-2-3-6-17(16)30-14-20(21,22)23;/h2-3,5-6,13H,4,7-12,14H2,1H3,(H,24,29);1H |
InChIKey | CWVABCXVOAVUJL-UHFFFAOYSA-N |
SMILES | CC1=CNC(=O)N(C1=O)CCCN2CCN(CC2)C3=CC=CC=C3OCC(F)(F)F.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |