For research use only. Not for therapeutic Use.
RSH-7（Cat No.:I042457）is a small molecule compound being investigated for its potential therapeutic applications in the treatment of various diseases, including cancer. It functions as an inhibitor of specific enzymes and signaling pathways that play crucial roles in cell growth, survival, and proliferation. By targeting these pathways, RSH-7 may disrupt tumor growth and metastasis, making it a promising candidate for cancer therapy. Research is ongoing to evaluate its effectiveness, particularly in cancers that are resistant to traditional treatments, as well as its potential to enhance the efficacy of existing cancer therapies.
| CAS Number | 2764609-97-2 |
| Synonyms | 2-[[5-fluoro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzohydrazide |
| Molecular Formula | C22H25FN8O |
| Purity | ≥95% |
| IUPAC Name | 2-[[5-fluoro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]benzohydrazide |
| InChI | InChI=1S/C22H25FN8O/c1-30-10-12-31(13-11-30)16-8-6-15(7-9-16)26-22-25-14-18(23)20(28-22)27-19-5-3-2-4-17(19)21(32)29-24/h2-9,14H,10-13,24H2,1H3,(H,29,32)(H2,25,26,27,28) |
| InChIKey | MGPNQCUHKOUGKG-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)NC4=CC=CC=C4C(=O)NN)F |
