For research use only. Not for therapeutic Use.
(S)-(-)-ALPHA,ALPHA-DIPHENYL-2-PYRROLIDINYL METHYLTMS ETHER (Cat.No:R073719) is a chiral reagent used in organic synthesis. It serves as a source of the chiral pyrrolidine unit and is employed to introduce chirality into various molecules. This compound finds applications in asymmetric synthesis and the preparation of complex molecules with specific stereochemistry.
| Catalog Number | R073719 |
| CAS Number | 848821-58-9 |
| Molecular Formula | C20H27NOSi |
| Purity | ≥95% |
| IUPAC Name | [diphenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane |
| InChI | InChI=1S/C20H27NOSi/c1-23(2,3)22-20(19-15-10-16-21-19,17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,19,21H,10,15-16H2,1-3H3/t19-/m0/s1 |
| InChIKey | RSUHWMSTWSSNOW-IBGZPJMESA-N |
| SMILES | C[Si](C)(C)OC(C1CCCN1)(C2=CC=CC=C2)C3=CC=CC=C3 |
