For research use only. Not for therapeutic Use.
RUNX1/ETO tetramerization-IN-1（Cat No.:I043121）is a small molecule inhibitor designed to target the interaction between the RUNX1 and ETO fusion protein, which is implicated in certain leukemias, particularly acute myeloid leukemia (AML). RUNX1/ETO is known to form tetramers that contribute to the oncogenic properties of the fusion protein. IN-1 disrupts this tetramerization process, preventing the formation of these complexes and thereby inhibiting the oncogenic signaling pathways. As a result, IN-1 holds promise as a potential therapeutic agent for AML and other cancers driven by RUNX1/ETO fusion protein activity.
| CAS Number | 88755-39-9 |
| Synonyms | 2,4-bis(1,3-benzodioxol-5-yl)-4-oxobutanoic acid |
| Molecular Formula | C18H14O7 |
| Purity | ≥95% |
| IUPAC Name | 2,4-bis(1,3-benzodioxol-5-yl)-4-oxobutanoic acid |
| InChI | InChI=1S/C18H14O7/c19-13(11-2-4-15-17(6-11)25-9-23-15)7-12(18(20)21)10-1-3-14-16(5-10)24-8-22-14/h1-6,12H,7-9H2,(H,20,21) |
| InChIKey | PPEBBOHQEAQKSW-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(CC(=O)C3=CC4=C(C=C3)OCO4)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
