For research use only. Not for therapeutic Use.
Rutarin is a Coumarin (HY-N0709) derivative, that can be isolated from the aerial parts of the plant Atalantta racemosa[1].
| Catalog Number | I035820 |
| CAS Number | 20320-81-4 |
| Synonyms | 2-(2-hydroxypropan-2-yl)-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrofuro[3,2-g]chromen-7-one |
| Molecular Formula | C20H24O10 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H24O10/c1-20(2,26)11-6-9-5-8-3-4-12(22)29-16(8)18(17(9)28-11)30-19-15(25)14(24)13(23)10(7-21)27-19/h3-5,10-11,13-15,19,21,23-26H,6-7H2,1-2H3 |
| InChIKey | JWWFVRMFYKPZNE-UHFFFAOYSA-N |
| SMILES | CC(C)(C1CC2=C(O1)C(=C3C(=C2)C=CC(=O)O3)OC4C(C(C(C(O4)CO)O)O)O)O |
| Reference | [1]. Banerji A, et al. Prenylated compounds from Atalantia racemosa: isolation and synthesis of two pyranoflavones. Phytochemistry, 1988, 27(11):3637-3640. |
