For research use only. Not for therapeutic Use.
Dehydrocrenatidine(Cat No.:I000388)is a bioactive alkaloid derived from the plant Radix Menispermi, known for its diverse pharmacological properties. It exhibits significant anti-inflammatory, analgesic, and antitumor activities, making it a subject of interest in medicinal research. Studies have shown that dehydrocrenatidine can inhibit the proliferation of various cancer cell lines and induce apoptosis through multiple signaling pathways. Additionally, it possesses antioxidant properties, contributing to its protective effects against oxidative stress. Dehydrocrenatidine’s multifaceted therapeutic potential highlights its promise as a candidate for developing new treatments in oncology and inflammation-related conditions.
CAS Number | 1092939-16-6 |
Synonyms | 3-(4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl)-3-cyclopentylpropanenitrile sulfate |
Molecular Formula | C17H20N6O4S |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 3.3 nM/2.8 nM(JAK1/JAK2) |
IUPAC Name | 3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile;sulfuric acid |
InChI | InChI=1S/C17H18N6.H2O4S/c18-7-5-15(12-3-1-2-4-12)23-10-13(9-22-23)16-14-6-8-19-17(14)21-11-20-16;1-5(2,3)4/h6,8-12,15H,1-5H2,(H,19,20,21);(H2,1,2,3,4) |
InChIKey | LGJWVXWQCTZSGC-UHFFFAOYSA-N |
SMILES | C1CCC(C1)C(CC#N)N2C=C(C=N2)C3=C4C=CNC4=NC=N3.OS(=O)(=O)O |
Reference | <p style=/line-height:25px/> <br>[2]. Verstovsek S, et al. A double-blind, placebo-controlled trial of ruxolitinib for myelofibrosis. N Engl J Med, 2012, 366(9), 799-807. </p> |