For research use only. Not for therapeutic Use.
Ruzinurad (HR011303) is a highly selective URATl inhibitor (WO2020088641, compound I). Ruzinurad can be used in the study of hyperuricemia[1].
Ruzinurad is a highly selective URATl inhibitor[1].
| Catalog Number | I035824 |
| CAS Number | 1638327-48-6 |
| Synonyms | 1-(6-bromoquinolin-4-yl)sulfanylcyclobutane-1-carboxylic acid |
| Molecular Formula | C14H12BrNO2S |
| Purity | ≥95% |
| InChI | InChI=1S/C14H12BrNO2S/c15-9-2-3-11-10(8-9)12(4-7-16-11)19-14(13(17)18)5-1-6-14/h2-4,7-8H,1,5-6H2,(H,17,18) |
| InChIKey | QGBWIYLNOBYNDL-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C(=O)O)SC2=C3C=C(C=CC3=NC=C2)Br |
| Reference | [1]. WO2020088641 |
