For research use only. Not for therapeutic Use.
RVX-297 is a small-molecule inhibitor of bromodomain and extra-terminal (BET) proteins, specifically targeting BRD4. BET proteins are involved in regulating gene expression, particularly those related to inflammation and cell growth. RVX-297 has been studied for its potential to modulate immune and inflammatory responses by inhibiting the activity of BRD4, which plays a key role in promoting the expression of pro-inflammatory genes. This compound shows promise in treating autoimmune and inflammatory diseases, such as multiple sclerosis and rheumatoid arthritis, by reducing inflammation and immune system overactivation. Its targeted action makes RVX-297 a valuable candidate for developing therapies in immunology.
CAS Number | 1044871-04-6 |
Synonyms | 2-[3,5-dimethyl-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,7-dimethoxy-3H-quinazolin-4-one |
Molecular Formula | C24H29N3O4 |
Purity | ≥95% |
InChI | InChI=1S/C24H29N3O4/c1-15-11-17(12-16(2)22(15)31-10-9-27-7-5-6-8-27)23-25-19-13-18(29-3)14-20(30-4)21(19)24(28)26-23/h11-14H,5-10H2,1-4H3,(H,25,26,28) |
InChIKey | PQZDYFRDRHRZGF-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1OCCN2CCCC2)C)C3=NC4=C(C(=CC(=C4)OC)OC)C(=O)N3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |