For research use only. Not for therapeutic Use.
RX 801077 hydrochloride(Cat No.:R042519)is a synthetic small molecule compound under investigation for its potential therapeutic applications. It is primarily studied for its ability to modulate specific biological pathways, particularly in the context of cancer and neurodegenerative diseases. RX 801077 hydrochloride is known for its effects on cell signaling, with research focusing on its mechanism of action, safety, and efficacy. It is often examined in preclinical models to evaluate its potential as a novel treatment option. Ongoing studies aim to explore its pharmacokinetics, toxicity profile, and effectiveness in targeted disease therapies.
CAS Number | 89196-95-2 |
Synonyms | 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole;hydrochloride |
Molecular Formula | C11H11ClN2O |
Purity | ≥95% |
IUPAC Name | 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole;hydrochloride |
InChI | InChI=1S/C11H10N2O.ClH/c1-2-4-9-8(3-1)7-10(14-9)11-12-5-6-13-11;/h1-4,7H,5-6H2,(H,12,13);1H |
InChIKey | RFNFFVDVGWOSNZ-UHFFFAOYSA-N |
SMILES | C1CN=C(N1)C2=CC3=CC=CC=C3O2.Cl |