Home
>
Chemical Reagents>Chiral Reagents> (S)-1-(3-Bromophenyl)-2-methylpropan-1-amine hydrochloride
For research use only. Not for therapeutic Use.
(S)-1-(3-Bromophenyl)-2-methylpropan-1-amine hydrochloride (Cat.No:L003973) is a vital chiral compound in pharmaceutical research. Its unique structure, featuring a bromophenyl and methylpropanamine moiety, holds promise for the development of enantioselective drugs. This compound serves as a crucial intermediate in the synthesis of specialized pharmaceutical agents, highlighting its significance in the pursuit of novel therapeutic compounds.
CAS Number | 1391451-61-8 |
Molecular Formula | C10H15BrClN |
Purity | ≥95% |
IUPAC Name | (1S)-1-(3-bromophenyl)-2-methylpropan-1-amine;hydrochloride |
InChI | InChI=1S/C10H14BrN.ClH/c1-7(2)10(12)8-4-3-5-9(11)6-8;/h3-7,10H,12H2,1-2H3;1H/t10-;/m0./s1 |
InChIKey | NBIZUXWSIIGBEV-PPHPATTJSA-N |
SMILES | (1S)-1-(3-bromophenyl)-2-methylpropan-1-amine;hydrochloride |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |