Home
>
Catalysts and Ligands>Chiral phosphine ligands> (S)-1-(3-(tert-butyl)-2,3-dihydrobenzo[d][1,3]oxaphosphol-4-yl)-2,5-diphenyl-1H-pyrrole
For research use only. Not for therapeutic Use.
(S)-1-(3-(tert-butyl)-2,3-dihydrobenzo[d][1,3]oxaphosphol-4-yl)-2,5-diphenyl-1H-pyrrole (Cat.No:L003645) is a pivotal compound in medicinal chemistry. Its intricate structure, featuring a phosphorus-containing heterocycle, holds promise for innovative drug development. This chiral molecule exhibits diverse biological activity, making it a valuable scaffold for pharmaceutical research. Its significance lies in its potential contribution to the development of novel therapeutic agents, emphasizing its role in modern drug discovery endeavors.
Catalog Number | L003645 |
CAS Number | 1683581-58-9 |
Molecular Formula | C27H26NOP |
Purity | ≥95% |
IUPAC Name | 1-[(3S)-3-tert-butyl-2H-1,3-benzoxaphosphol-4-yl]-2,5-diphenylpyrrole |
InChI | InChI=1S/C27H26NOP/c1-27(2,3)30-19-29-25-16-10-15-24(26(25)30)28-22(20-11-6-4-7-12-20)17-18-23(28)21-13-8-5-9-14-21/h4-18H,19H2,1-3H3/t30-/m1/s1 |
InChIKey | KJXNLTFQUPGVAM-SSEXGKCCSA-N |
SMILES | CC(C)(C)[P@@]1COC2=CC=CC(=C21)N3C(=CC=C3C4=CC=CC=C4)C5=CC=CC=C5 |