For research use only. Not for therapeutic Use.
(S)-1-(3-TRIFLUOROMETHYLPHENYL)-2-AMINOPROPANE (Cat.No: M087547) is an organic compound used to treat primary pulmonary hypertension. As an agonist of 5-HT2 receptor, it can cause nerve endings to release serotonin. This in turn causes the release of vasoactive substances and high proliferative diseases, leading to elevated blood pressure.
CAS Number | 19036-73-8 |
Molecular Formula | C10H12F3N |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | (2S)-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
InChI | InChI=1S/C10H12F3N/c1-7(14)5-8-3-2-4-9(6-8)10(11,12)13/h2-4,6-7H,5,14H2,1H3/t7-/m0/s1 |
InChIKey | MLBHFBKZUPLWBD-ZETCQYMHSA-N |
SMILES | CC(CC1=CC(=CC=C1)C(F)(F)F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |