For research use only. Not for therapeutic Use.
(S)-1-Phenylpyrrolidin-3-amine hydrochloride(Cat No.:L007751), is a chemical compound with a molecular structure consisting of a pyrrolidine ring containing a phenyl group and an amino group (NH2). The compound is in the form of its hydrochloride salt, which enhances its stability and solubility in aqueous solutions. Compounds similar to (S)-1-Phenylpyrrolidin-3-amine are often utilized in organic synthesis and medicinal chemistry research. Researchers might study its properties, reactions, and potential biological activities, to develop new drugs or understand its role in biological systems.
CAS Number | 1955474-17-5 |
Molecular Formula | C10H15ClN2 |
Purity | ≥95% |
IUPAC Name | (3S)-1-phenylpyrrolidin-3-amine;hydrochloride |
InChI | InChI=1S/C10H14N2.ClH/c11-9-6-7-12(8-9)10-4-2-1-3-5-10;/h1-5,9H,6-8,11H2;1H/t9-;/m0./s1 |
InChIKey | BLERKSUNNKETEP-FVGYRXGTSA-N |
SMILES | C1CN(CC1N)C2=CC=CC=C2.Cl |