For research use only. Not for therapeutic Use.
(S)-(+)-1,2-Propanediol (Cat No.: I015562) is a naturally occurring metabolite in the body. This compound holds significance in the synthesis of chiral drugs, particularly those where the stereochemistry of molecules is essential for their pharmacological activity. Its enantiomerically pure form, as (S)-(+)-1,2-Propanediol, allows for precise control over the stereochemistry in drug synthesis, enhancing the selectivity and efficacy of pharmaceutical compounds. Researchers and pharmaceutical manufacturers frequently utilize it in drug development processes to create chiral drugs with the desired therapeutic properties.
Catalog Number | I015562 |
CAS Number | 4254-15-3 |
Molecular Formula | C₃H₈O₂ |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Room Temperature |
IUPAC Name | (2S)-propane-1,2-diol |
InChI | InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3/t3-/m0/s1 |
InChIKey | DNIAPMSPPWPWGF-VKHMYHEASA-N |
SMILES | CC(CO)O |