For research use only. Not for therapeutic Use.
(S)-2-(1-Aminoethyl)-4-fluorophenol hydrochloride (Cat.No:L003886) is a crucial chiral compound in pharmaceutical research. Its unique structure, incorporating an aminoethyl group and a fluorophenol motif, imparts distinctive pharmacological properties. This compound is employed as a key intermediate in the synthesis of pharmaceutical agents with potential therapeutic applications.
CAS Number | 2379311-62-1 |
Molecular Formula | C8H11ClFNO |
Purity | ≥95% |
IUPAC Name | 2-[(1S)-1-aminoethyl]-4-fluorophenol;hydrochloride |
InChI | InChI=1S/C8H10FNO.ClH/c1-5(10)7-4-6(9)2-3-8(7)11;/h2-5,11H,10H2,1H3;1H/t5-;/m0./s1 |
InChIKey | WNTRCWFPNVNFGW-JEDNCBNOSA-N |
SMILES | C[C@@H](C1=C(C=CC(=C1)F)O)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |