Home
>
Chemical Reagents>Heterocyclic Building Blocks> (S)-2-(3,4-Difluorophenyl)pyrrolidine hydrochloride
For research use only. Not for therapeutic Use.
(S)-2-(3,4-Difluorophenyl)pyrrolidine hydrochloride (Cat.No:L003919) is a vital compound in pharmaceutical research. Its chiral pyrrolidine structure, along with a difluorophenyl group, imparts unique pharmacological properties. This compound is a crucial intermediate in the synthesis of specialized pharmaceutical agents, particularly in the development of potential therapeutic drugs.
Catalog Number | L003919 |
CAS Number | 2177258-16-9 |
Molecular Formula | C10H12ClF2N |
Purity | ≥95% |
IUPAC Name | (2S)-2-(3,4-difluorophenyl)pyrrolidine;hydrochloride |
InChI | InChI=1S/C10H11F2N.ClH/c11-8-4-3-7(6-9(8)12)10-2-1-5-13-10;/h3-4,6,10,13H,1-2,5H2;1H/t10-;/m0./s1 |
InChIKey | PXMDJKBIGCGCEY-PPHPATTJSA-N |
SMILES | C1C[C@H](NC1)C2=CC(=C(C=C2)F)F.Cl |