For research use only. Not for therapeutic Use.
(S)-2-[[4-[(3-Fluorobenzyl)oxy]benzyl]amino]propionic acid (Cat C000823) is a chemical compound with potential pharmaceutical relevance. Its structure features an amino acid moiety combined with a fluorobenzyl ether and a benzylamine group. This compound may possess bioactive properties and is likely being studied for potential therapeutic applications, such as in drug development or medicinal chemistry. Its precise uses, biological activities, and mechanisms of action would be outlined in scientific literature, contributing to advancements in pharmacology and providing insights into its potential role in various medical treatments.
CAS Number | 1160513-60-9 |
Synonyms | N-?[[4-?[(3-?Fluorophenyl)?methoxy]?phenyl]?methyl]?-L-?Alanine, |
Molecular Formula | C₁₇H₁₈FNO₃ |
Purity | ≥95% |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Appearance | White to Off-White Solid |
Storage | 4°C, Inert atmosphere |
IUPAC Name | (2S)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methylamino]propanoic acid |
InChI | InChI=1S/C17H18FNO3/c1-12(17(20)21)19-10-13-5-7-16(8-6-13)22-11-14-3-2-4-15(18)9-14/h2-9,12,19H,10-11H2,1H3,(H,20,21)/t12-/m0/s1 |
InChIKey | OMBVXGARDCQQMQ-LBPRGKRZSA-N |
SMILES | CC(C(=O)O)NCC1=CC=C(C=C1)OCC2=CC(=CC=C2)F |
Reference | Finberg, J.P.M., et al.: Front Pharmacol., 7, 340-54 (2016); |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |