For research use only. Not for therapeutic Use.
(S)-2-(4-(Methylsulfonyl)piperazin-1-yl)propan-1-ol (Cat.No:L003425) is a key compound in medicinal chemistry. Its chiral nature and unique piperazine scaffold make it a valuable building block for drug synthesis. This compound exhibits promising pharmacological properties, highlighting its potential in the development of novel pharmaceuticals.
Catalog Number | L003425 |
CAS Number | 2381259-96-5 |
Molecular Formula | C8H18N2O3S |
Purity | ≥95% |
IUPAC Name | (2S)-2-(4-methylsulfonylpiperazin-1-yl)propan-1-ol |
InChI | InChI=1S/C8H18N2O3S/c1-8(7-11)9-3-5-10(6-4-9)14(2,12)13/h8,11H,3-7H2,1-2H3/t8-/m0/s1 |
InChIKey | CQWZDNQPWZGQGY-QMMMGPOBSA-N |
SMILES | C[C@@H](CO)N1CCN(CC1)S(=O)(=O)C |