For research use only. Not for therapeutic Use.
(S)-2-Amino-2-(2-bromophenyl)ethanol (Cat.No:L004135) is a crucial chiral compound with applications in pharmaceutical research. Its unique structure, featuring a bromophenyl and amino group, imparts specific pharmacological potential. This compound serves as a valuable intermediate in the synthesis of enantiopure pharmaceutical agents, particularly in the development of therapeutic drugs.
CAS Number | 1213600-83-9 |
Molecular Formula | C8H10BrNO |
Purity | ≥95% |
IUPAC Name | (2S)-2-amino-2-(2-bromophenyl)ethanol |
InChI | InChI=1S/C8H10BrNO/c9-7-4-2-1-3-6(7)8(10)5-11/h1-4,8,11H,5,10H2/t8-/m1/s1 |
InChIKey | VUSFGKBTMASDCO-MRVPVSSYSA-N |
SMILES | C1=CC=C(C(=C1)[C@@H](CO)N)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |