Home
>
Chemical Reagents>Organic Building Blocks> (S)-2-Amino-2-(2-bromophenyl)ethanol hydrochloride
For research use only. Not for therapeutic Use.
(S)-2-Amino-2-(2-bromophenyl)ethanol hydrochloride (Cat.No:L003723) is a crucial chiral compound used in pharmaceutical research. Its unique structure, incorporating a bromophenyl moiety, offers distinct reactivity. This compound serves as a valuable intermediate in the synthesis of specialized pharmaceutical agents. The chirality of the molecule makes it especially significant in the development of enantioselective drugs, emphasizing its importance in contemporary medicinal chemistry.
Catalog Number | L003723 |
CAS Number | 1391398-48-3 |
Molecular Formula | C8H11BrClNO |
Purity | ≥95% |
IUPAC Name | (2S)-2-amino-2-(2-bromophenyl)ethanol;hydrochloride |
InChI | InChI=1S/C8H10BrNO.ClH/c9-7-4-2-1-3-6(7)8(10)5-11;/h1-4,8,11H,5,10H2;1H/t8-;/m1./s1 |
InChIKey | FHWGMOICMCKSHB-DDWIOCJRSA-N |
SMILES | C1=CC=C(C(=C1)[C@@H](CO)N)Br.Cl |