Home
>
Chemical Reagents>Organic Building Blocks>
>
(S)-2-Amino-2-(3-nitrophenyl)ethan-1-ol hydrochloride
(S)-2-Amino-2-(3-nitrophenyl)ethan-1-ol hydrochloride (Cat.No:L003686) is a vital chiral compound with significant applications in pharmaceutical research. Its unique stereochemistry and functional groups confer specific pharmacological properties. This compound plays a crucial role as an intermediate in the synthesis of potential therapeutic agents.
Catalog Number | L003686 |
CAS Number | 2453296-88-1 |
Molecular Formula | C8H11ClN2O3 |
Purity | ≥95% |
IUPAC Name | (2S)-2-amino-2-(3-nitrophenyl)ethanol;hydrochloride |
InChI | InChI=1S/C8H10N2O3.ClH/c9-8(5-11)6-2-1-3-7(4-6)10(12)13;/h1-4,8,11H,5,9H2;1H/t8-;/m1./s1 |
InChIKey | FMKDBVMPPKFPSH-DDWIOCJRSA-N |
SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])[C@@H](CO)N.Cl |