For research use only. Not for therapeutic Use.
(S)-2-Amino-3-(4-fluoro-1H-indol-3-yl)-propionic acid(Cat No.:M000960) is a chiral amino acid derivative, structurally similar to tryptophan but with a fluorine atom substituted at the 4-position on the indole ring. This modification introduces unique electronic properties due to the electronegativity of fluorine, potentially affecting the molecule’s biological interactions and stability. It is primarily of interest in biochemical and pharmaceutical research, where it might be explored as a building block for peptide synthesis or as a precursor for creating novel compounds aimed at neurological or therapeutic applications. Its specific configuration (S)-enantiomer indicates its potential for high specificity in biological systems.
CAS Number | 106034-22-4 |
Molecular Formula | C11H11FN2O2 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | (2S)-2-amino-3-(4-fluoro-1H-indol-3-yl)propanoic acid |
InChI | InChI=1S/C11H11FN2O2/c12-7-2-1-3-9-10(7)6(5-14-9)4-8(13)11(15)16/h1-3,5,8,14H,4,13H2,(H,15,16)/t8-/m0/s1 |
InChIKey | DEBQMEYEKKWIKC-QMMMGPOBSA-N |
SMILES | C1=CC2=C(C(=C1)F)C(=CN2)CC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |