For research use only. Not for therapeutic Use.
(S)-2-Aminopent-4-ynoic acid is a synthetic amino acid. (S)-2-Aminopent-4-ynoic acid can be used in synthesis of folate-conjugates and corresponding metal-chelate complexes[1]. (S)-2-Aminopent-4-ynoic acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
Catalog Number | I014452 |
CAS Number | 23235-01-0 |
Synonyms | (2S)-2-aminopent-4-ynoic acid |
Molecular Formula | C5H7NO2 |
Purity | ≥95% |
InChI | InChI=1S/C5H7NO2/c1-2-3-4(6)5(7)8/h1,4H,3,6H2,(H,7,8)/t4-/m0/s1 |
InChIKey | DGYHPLMPMRKMPD-BYPYZUCNSA-N |
SMILES | C#CCC(C(=O)O)N |
Reference | [1]. Rudolf Moser, et al.Folate-conjugates and corresponding metal-chelate complexes for use in diagnostic imaging and radiotherapy. WO2008125618A1 |