For research use only. Not for therapeutic Use.
(S)-2-Bromopropionic Acid (Cat.No:R003524) is a chiral organic compound used in the synthesis of various pharmaceuticals and fine chemicals. Its specific stereochemistry, denoted by the “(S)” designation, is essential for controlling the chirality of target molecules, making it valuable in asymmetric synthesis and drug development processes.
Catalog Number | R003524 |
CAS Number | 32644-15-8 |
Synonyms | (2S)-2-Bromopropanoic Acid; (S)-α-Bromopropionic Acid; (-)-α-Bromopropanoic Acid; L-α-Bromopropionic Acid; L-2-Bromopropionic Acid; (S)-(-)-2-Bromopropionic Acid; (S)-2-Bromopropanoic Acid; (S)-2-Bromopropionic Acid; (S)-α-Bromopropionic Acid; L-2-Br |
Molecular Formula | C3H5BrO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S)-2-bromopropanoic acid |
InChI | InChI=1S/C3H5BrO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6)/t2-/m0/s1 |
InChIKey | MONMFXREYOKQTI-REOHCLBHSA-N |
SMILES | CC(C(=O)O)Br |