For research use only. Not for therapeutic Use.
S-(2-Carboxypropyl)-L-cysteine(Cat No.:I042516)is a sulfur-containing amino acid derivative involved in cellular metabolism and antioxidant defense. It is formed by the conjugation of L-cysteine with 2-carboxypropyl groups, and its primary role is in the detoxification of reactive molecules, including reactive oxygen species (ROS). This compound has shown potential as a protective agent in oxidative stress-related conditions. Research suggests that S-(2-carboxypropyl)-L-cysteine may contribute to reducing inflammation and promoting cellular repair mechanisms, offering potential therapeutic applications in diseases associated with oxidative damage, such as neurodegenerative disorders and cardiovascular diseases.
CAS Number | 6852-42-2 |
Synonyms | 3-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-methylpropanoic acid |
Molecular Formula | C7H13NO4S |
Purity | ≥95% |
IUPAC Name | 3-[(2R)-2-amino-2-carboxyethyl]sulfanyl-2-methylpropanoic acid |
InChI | InChI=1S/C7H13NO4S/c1-4(6(9)10)2-13-3-5(8)7(11)12/h4-5H,2-3,8H2,1H3,(H,9,10)(H,11,12)/t4?,5-/m0/s1 |
InChIKey | QSPWUNSFUXUUDG-AKGZTFGVSA-N |
SMILES | CC(CSC[C@@H](C(=O)O)N)C(=O)O |